C25H21F7O2 — CID 21282141
1-phenoxy-3-[5,5,5-trifluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pentyl]benzene (PubChem CID 21282141) has the molecular formula C25H21F7O2 and a molecular weight of 486.43 g/mol. Its IUPAC name is 1-phenoxy-3-[5,5,5-trifluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pentyl]benzene.
| Compound Name | 1-phenoxy-3-[5,5,5-trifluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pentyl]benzene |
|---|---|
| PubChem CID | 21282141 |
| Molecular Formula | C25H21F7O2 |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 1-phenoxy-3-[5,5,5-trifluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pentyl]benzene |
| SMILES | FC(F)C(F)(F)Oc1ccc(C(CCCc2cccc(Oc3ccccc3)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H21F7O2/c26-23(27)25(31,32)34-20-14-12-18(13-15-20)22(24(28,29)30)11-5-7-17-6-4-10-21(16-17)33-19-8-2-1-3-9-19/h1-4,6,8-10,12-16,22-23H,5,7,11H2 |
| InChIKey | ABQMPPQWQOWXOR-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|