C26H26F4O2S — CID 151813103
1-[2-methyl-1-[(3-phenoxyphenyl)methylsulfanyl]butan-2-yl]-4-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 151813103) has the molecular formula C26H26F4O2S and a molecular weight of 478.55 g/mol. Its IUPAC name is 1-[2-methyl-1-[(3-phenoxyphenyl)methylsulfanyl]butan-2-yl]-4-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 1-[2-methyl-1-[(3-phenoxyphenyl)methylsulfanyl]butan-2-yl]-4-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 151813103 |
| Molecular Formula | C26H26F4O2S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 1-[2-methyl-1-[(3-phenoxyphenyl)methylsulfanyl]butan-2-yl]-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | CCC(C)(CSCc1cccc(Oc2ccccc2)c1)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C26H26F4O2S/c1-3-25(2,20-12-14-22(15-13-20)32-26(29,30)24(27)28)18-33-17-19-8-7-11-23(16-19)31-21-9-5-4-6-10-21/h4-16,24H,3,17-18H2,1-2H3 |
| InChIKey | SBAMWNHBBYJEEZ-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|