C25H25ClF2O2 — CID 14155768
1-[chloro(difluoro)methoxy]-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene (PubChem CID 14155768) has the molecular formula C25H25ClF2O2 and a molecular weight of 430.92 g/mol. Its IUPAC name is 1-[chloro(difluoro)methoxy]-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene.
| Compound Name | 1-[chloro(difluoro)methoxy]-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene |
|---|---|
| PubChem CID | 14155768 |
| Molecular Formula | C25H25ClF2O2 |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-[chloro(difluoro)methoxy]-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene |
| SMILES | CC(C)(CCCc1cccc(Oc2ccccc2)c1)c1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C25H25ClF2O2/c1-24(2,20-13-15-22(16-14-20)30-25(26,27)28)17-7-9-19-8-6-12-23(18-19)29-21-10-4-3-5-11-21/h3-6,8,10-16,18H,7,9,17H2,1-2H3 |
| InChIKey | UZHRXVNPKFJAQR-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|