C27H25F5O3 — CID 139767354
3-methyl-3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-6-(3-phenoxyphenyl)hexan-2-one (PubChem CID 139767354) has the molecular formula C27H25F5O3 and a molecular weight of 492.48 g/mol. Its IUPAC name is 3-methyl-3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-6-(3-phenoxyphenyl)hexan-2-one.
| Compound Name | 3-methyl-3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-6-(3-phenoxyphenyl)hexan-2-one |
|---|---|
| PubChem CID | 139767354 |
| Molecular Formula | C27H25F5O3 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 3-methyl-3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-6-(3-phenoxyphenyl)hexan-2-one |
| SMILES | CC(=O)C(C)(CCCc1cccc(Oc2ccccc2)c1)c1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H25F5O3/c1-19(33)25(2,21-13-15-23(16-14-21)35-27(31,32)26(28,29)30)17-7-9-20-8-6-12-24(18-20)34-22-10-4-3-5-11-22/h3-6,8,10-16,18H,7,9,17H2,1-2H3 |
| InChIKey | NPQVKLAPMFCNAG-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|