C24H24BrClO — CID 21269797
1-bromo-2-chloro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene (PubChem CID 21269797) has the molecular formula C24H24BrClO and a molecular weight of 443.81 g/mol. Its IUPAC name is 1-bromo-2-chloro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene.
| Compound Name | 1-bromo-2-chloro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene |
|---|---|
| PubChem CID | 21269797 |
| Molecular Formula | C24H24BrClO |
| Molecular Weight | 443.81 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 1-bromo-2-chloro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene |
| SMILES | CC(C)(CCCc1cccc(Oc2ccccc2)c1)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C24H24BrClO/c1-24(2,19-13-14-22(25)23(26)17-19)15-7-9-18-8-6-12-21(16-18)27-20-10-4-3-5-11-20/h3-6,8,10-14,16-17H,7,9,15H2,1-2H3 |
| InChIKey | KXRJFFVTJHLQDA-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.81 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |