C25H27FO — CID 21269746
1-fluoro-4-[3-[4-methyl-4-(3-methylphenyl)pentyl]phenoxy]benzene (PubChem CID 21269746) has the molecular formula C25H27FO and a molecular weight of 362.49 g/mol. Its IUPAC name is 1-fluoro-4-[3-[4-methyl-4-(3-methylphenyl)pentyl]phenoxy]benzene.
| Compound Name | 1-fluoro-4-[3-[4-methyl-4-(3-methylphenyl)pentyl]phenoxy]benzene |
|---|---|
| PubChem CID | 21269746 |
| Molecular Formula | C25H27FO |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-fluoro-4-[3-[4-methyl-4-(3-methylphenyl)pentyl]phenoxy]benzene |
| SMILES | Cc1cccc(C(C)(C)CCCc2cccc(Oc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C25H27FO/c1-19-7-4-10-21(17-19)25(2,3)16-6-9-20-8-5-11-24(18-20)27-23-14-12-22(26)13-15-23/h4-5,7-8,10-15,17-18H,6,9,16H2,1-3H3 |
| InChIKey | VYDSOCSMJYPINS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |