C25H26ClFO — CID 21269768
4-[4-(4-chlorophenyl)-4-methylpentyl]-1-fluoro-2-(3-methylphenoxy)benzene (PubChem CID 21269768) has the molecular formula C25H26ClFO and a molecular weight of 396.93 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-4-methylpentyl]-1-fluoro-2-(3-methylphenoxy)benzene.
| Compound Name | 4-[4-(4-chlorophenyl)-4-methylpentyl]-1-fluoro-2-(3-methylphenoxy)benzene |
|---|---|
| PubChem CID | 21269768 |
| Molecular Formula | C25H26ClFO |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-4-methylpentyl]-1-fluoro-2-(3-methylphenoxy)benzene |
| SMILES | Cc1cccc(Oc2cc(CCCC(C)(C)c3ccc(Cl)cc3)ccc2F)c1 |
| InChI | InChI=1S/C25H26ClFO/c1-18-6-4-8-22(16-18)28-24-17-19(9-14-23(24)27)7-5-15-25(2,3)20-10-12-21(26)13-11-20/h4,6,8-14,16-17H,5,7,15H2,1-3H3 |
| InChIKey | AKDOXPXBFSCXIF-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |