C26H28BrFO2 — CID 21269692
2-(4-bromophenoxy)-4-[4-(4-ethoxyphenyl)-4-methylpentyl]-1-fluorobenzene (PubChem CID 21269692) has the molecular formula C26H28BrFO2 and a molecular weight of 471.41 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-4-[4-(4-ethoxyphenyl)-4-methylpentyl]-1-fluorobenzene.
| Compound Name | 2-(4-bromophenoxy)-4-[4-(4-ethoxyphenyl)-4-methylpentyl]-1-fluorobenzene |
|---|---|
| PubChem CID | 21269692 |
| Molecular Formula | C26H28BrFO2 |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-(4-bromophenoxy)-4-[4-(4-ethoxyphenyl)-4-methylpentyl]-1-fluorobenzene |
| SMILES | CCOc1ccc(C(C)(C)CCCc2ccc(F)c(Oc3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C26H28BrFO2/c1-4-29-22-12-8-20(9-13-22)26(2,3)17-5-6-19-7-16-24(28)25(18-19)30-23-14-10-21(27)11-15-23/h7-16,18H,4-6,17H2,1-3H3 |
| InChIKey | AOZDUTZPXNDUEG-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |