C25H24F4OS — CID 54014319
1-fluoro-4-[4-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]pentyl]-2-phenoxybenzene (PubChem CID 54014319) has the molecular formula C25H24F4OS and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-fluoro-4-[4-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]pentyl]-2-phenoxybenzene.
| Compound Name | 1-fluoro-4-[4-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]pentyl]-2-phenoxybenzene |
|---|---|
| PubChem CID | 54014319 |
| Molecular Formula | C25H24F4OS |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1-fluoro-4-[4-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]pentyl]-2-phenoxybenzene |
| SMILES | CC(C)(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H24F4OS/c1-24(2,19-11-13-21(14-12-19)31-25(27,28)29)16-6-7-18-10-15-22(26)23(17-18)30-20-8-4-3-5-9-20/h3-5,8-15,17H,6-7,16H2,1-2H3 |
| InChIKey | KUNWAUNJUZFMJA-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |