C25H23ClF2O — CID 70414183
1-chloro-2-fluoro-4-[6-(4-fluoro-3-phenoxyphenyl)-3-methylhex-1-en-3-yl]benzene (PubChem CID 70414183) has the molecular formula C25H23ClF2O and a molecular weight of 412.91 g/mol. Its IUPAC name is 1-chloro-2-fluoro-4-[6-(4-fluoro-3-phenoxyphenyl)-3-methylhex-1-en-3-yl]benzene.
| Compound Name | 1-chloro-2-fluoro-4-[6-(4-fluoro-3-phenoxyphenyl)-3-methylhex-1-en-3-yl]benzene |
|---|---|
| PubChem CID | 70414183 |
| Molecular Formula | C25H23ClF2O |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1-chloro-2-fluoro-4-[6-(4-fluoro-3-phenoxyphenyl)-3-methylhex-1-en-3-yl]benzene |
| SMILES | C=CC(C)(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C25H23ClF2O/c1-3-25(2,19-12-13-21(26)23(28)17-19)15-7-8-18-11-14-22(27)24(16-18)29-20-9-5-4-6-10-20/h3-6,9-14,16-17H,1,7-8,15H2,2H3 |
| InChIKey | XUTHLNHHPUOZKA-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|