C29H29FO2 — CID 88645906
4-[4-ethyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-1-fluoro-2-phenoxybenzene (PubChem CID 88645906) has the molecular formula C29H29FO2 and a molecular weight of 428.55 g/mol. Its IUPAC name is 4-[4-ethyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-1-fluoro-2-phenoxybenzene.
| Compound Name | 4-[4-ethyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-1-fluoro-2-phenoxybenzene |
|---|---|
| PubChem CID | 88645906 |
| Molecular Formula | C29H29FO2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 4-[4-ethyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-1-fluoro-2-phenoxybenzene |
| SMILES | C#CC(CC)(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(OCC=C)cc1 |
| InChI | InChI=1S/C29H29FO2/c1-4-21-31-25-17-15-24(16-18-25)29(5-2,6-3)20-10-11-23-14-19-27(30)28(22-23)32-26-12-8-7-9-13-26/h2,4,7-9,12-19,22H,1,6,10-11,20-21H2,3H3 |
| InChIKey | QZCPETBCTOSBKW-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|