C28H29FO — CID 88645524
2-benzyl-4-[4-ethyl-4-(4-methoxyphenyl)hex-5-ynyl]-1-fluorobenzene (PubChem CID 88645524) has the molecular formula C28H29FO and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-benzyl-4-[4-ethyl-4-(4-methoxyphenyl)hex-5-ynyl]-1-fluorobenzene.
| Compound Name | 2-benzyl-4-[4-ethyl-4-(4-methoxyphenyl)hex-5-ynyl]-1-fluorobenzene |
|---|---|
| PubChem CID | 88645524 |
| Molecular Formula | C28H29FO |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-benzyl-4-[4-ethyl-4-(4-methoxyphenyl)hex-5-ynyl]-1-fluorobenzene |
| SMILES | C#CC(CC)(CCCc1ccc(F)c(Cc2ccccc2)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H29FO/c1-4-28(5-2,25-14-16-26(30-3)17-15-25)19-9-12-23-13-18-27(29)24(21-23)20-22-10-7-6-8-11-22/h1,6-8,10-11,13-18,21H,5,9,12,19-20H2,2-3H3 |
| InChIKey | NELFQOKXTPVVMH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|