C28H30FNO — CID 88645744
2-fluoro-5-[4-methyl-4-(4-propoxyphenyl)hex-5-ynyl]-N-phenylaniline (PubChem CID 88645744) has the molecular formula C28H30FNO and a molecular weight of 415.55 g/mol. Its IUPAC name is 2-fluoro-5-[4-methyl-4-(4-propoxyphenyl)hex-5-ynyl]-N-phenylaniline.
| Compound Name | 2-fluoro-5-[4-methyl-4-(4-propoxyphenyl)hex-5-ynyl]-N-phenylaniline |
|---|---|
| PubChem CID | 88645744 |
| Molecular Formula | C28H30FNO |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-fluoro-5-[4-methyl-4-(4-propoxyphenyl)hex-5-ynyl]-N-phenylaniline |
| SMILES | C#CC(C)(CCCc1ccc(F)c(Nc2ccccc2)c1)c1ccc(OCCC)cc1 |
| InChI | InChI=1S/C28H30FNO/c1-4-20-31-25-16-14-23(15-17-25)28(3,5-2)19-9-10-22-13-18-26(29)27(21-22)30-24-11-7-6-8-12-24/h2,6-8,11-18,21,30H,4,9-10,19-20H2,1,3H3 |
| InChIKey | MQYUYIGFXDUYQW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|