C26H23F4N — CID 88645588
2-fluoro-5-[4-methyl-4-[4-(trifluoromethyl)phenyl]hex-5-ynyl]-N-phenylaniline (PubChem CID 88645588) has the molecular formula C26H23F4N and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-fluoro-5-[4-methyl-4-[4-(trifluoromethyl)phenyl]hex-5-ynyl]-N-phenylaniline.
| Compound Name | 2-fluoro-5-[4-methyl-4-[4-(trifluoromethyl)phenyl]hex-5-ynyl]-N-phenylaniline |
|---|---|
| PubChem CID | 88645588 |
| Molecular Formula | C26H23F4N |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-fluoro-5-[4-methyl-4-[4-(trifluoromethyl)phenyl]hex-5-ynyl]-N-phenylaniline |
| SMILES | C#CC(C)(CCCc1ccc(F)c(Nc2ccccc2)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H23F4N/c1-3-25(2,20-12-14-21(15-13-20)26(28,29)30)17-7-8-19-11-16-23(27)24(18-19)31-22-9-5-4-6-10-22/h1,4-6,9-16,18,31H,7-8,17H2,2H3 |
| InChIKey | JPSGBPLRLARSLL-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|