C26H25F2N — CID 88645937
5-[4-ethyl-4-(4-fluorophenyl)hex-5-ynyl]-2-fluoro-N-phenylaniline (PubChem CID 88645937) has the molecular formula C26H25F2N and a molecular weight of 389.49 g/mol. Its IUPAC name is 5-[4-ethyl-4-(4-fluorophenyl)hex-5-ynyl]-2-fluoro-N-phenylaniline.
| Compound Name | 5-[4-ethyl-4-(4-fluorophenyl)hex-5-ynyl]-2-fluoro-N-phenylaniline |
|---|---|
| PubChem CID | 88645937 |
| Molecular Formula | C26H25F2N |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 5-[4-ethyl-4-(4-fluorophenyl)hex-5-ynyl]-2-fluoro-N-phenylaniline |
| SMILES | C#CC(CC)(CCCc1ccc(F)c(Nc2ccccc2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H25F2N/c1-3-26(4-2,21-13-15-22(27)16-14-21)18-8-9-20-12-17-24(28)25(19-20)29-23-10-6-5-7-11-23/h1,5-7,10-17,19,29H,4,8-9,18H2,2H3 |
| InChIKey | GDFCHRCWQNFNKL-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|