C27H25F3O2 — CID 88645525
4-[4-[4-(difluoromethoxy)phenyl]-4-ethylhex-5-ynyl]-1-fluoro-2-phenoxybenzene (PubChem CID 88645525) has the molecular formula C27H25F3O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 4-[4-[4-(difluoromethoxy)phenyl]-4-ethylhex-5-ynyl]-1-fluoro-2-phenoxybenzene.
| Compound Name | 4-[4-[4-(difluoromethoxy)phenyl]-4-ethylhex-5-ynyl]-1-fluoro-2-phenoxybenzene |
|---|---|
| PubChem CID | 88645525 |
| Molecular Formula | C27H25F3O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 4-[4-[4-(difluoromethoxy)phenyl]-4-ethylhex-5-ynyl]-1-fluoro-2-phenoxybenzene |
| SMILES | C#CC(CC)(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C27H25F3O2/c1-3-27(4-2,21-13-15-23(16-14-21)32-26(29)30)18-8-9-20-12-17-24(28)25(19-20)31-22-10-6-5-7-11-22/h1,5-7,10-17,19,26H,4,8-9,18H2,2H3 |
| InChIKey | KQGHVMQJRQCYFZ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|