C53H50F6O4 — CID 160807979
4-[4-[4-(difluoromethoxy)phenyl]-4-ethylhex-5-enyl]-1-fluoro-2-phenoxybenzene;4-[4-[4-(difluoromethoxy)phenyl]-4-methylhex-5-ynyl]-1-fluoro-2-phenoxybenzene (PubChem CID 160807979) has the molecular formula C53H50F6O4 and a molecular weight of 864.97 g/mol. Its IUPAC name is 4-[4-[4-(difluoromethoxy)phenyl]-4-ethylhex-5-enyl]-1-fluoro-2-phenoxybenzene;4-[4-[4-(difluoromethoxy)phenyl]-4-methylhex-5-ynyl]-1-fluoro-2-phenoxybenzene.
| Compound Name | 4-[4-[4-(difluoromethoxy)phenyl]-4-ethylhex-5-enyl]-1-fluoro-2-phenoxybenzene;4-[4-[4-(difluoromethoxy)phenyl]-4-methylhex-5-ynyl]-1-fluoro-2-phenoxybenzene |
|---|---|
| PubChem CID | 160807979 |
| Molecular Formula | C53H50F6O4 |
| Molecular Weight | 864.97 g/mol |
| Exact Mass | 864.36 |
| IUPAC Name | 4-[4-[4-(difluoromethoxy)phenyl]-4-ethylhex-5-enyl]-1-fluoro-2-phenoxybenzene;4-[4-[4-(difluoromethoxy)phenyl]-4-methylhex-5-ynyl]-1-fluoro-2-phenoxybenzene |
| SMILES | C#CC(C)(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1.C=CC(CC)(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C27H27F3O2.C26H23F3O2/c1-3-27(4-2,21-13-15-23(16-14-21)32-26(29)30)18-8-9-20-12-17-24(28)25(19-20)31-22-10-6-5-7-11-22;1-3-26(2,20-12-14-22(15-13-20)31-25(28)29)17-7-8-19-11-16-23(27)24(18-19)30-21-9-5-4-6-10-21/h3,5-7,10-17,19,26H,1,4,8-9,18H2,2H3;1,4-6,9-16,18,25H,7-8,17H2,2H3 |
| InChIKey | SDYFTQBAKBDDOI-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.97 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|