C28H27FO2 — CID 14279526
1-fluoro-4-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-2-phenoxybenzene (PubChem CID 14279526) has the molecular formula C28H27FO2 and a molecular weight of 414.52 g/mol. Its IUPAC name is 1-fluoro-4-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-2-phenoxybenzene.
| Compound Name | 1-fluoro-4-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-2-phenoxybenzene |
|---|---|
| PubChem CID | 14279526 |
| Molecular Formula | C28H27FO2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 1-fluoro-4-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-2-phenoxybenzene |
| SMILES | C#CC(C)(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(OCC=C)cc1 |
| InChI | InChI=1S/C28H27FO2/c1-4-20-30-24-16-14-23(15-17-24)28(3,5-2)19-9-10-22-13-18-26(29)27(21-22)31-25-11-7-6-8-12-25/h2,4,6-8,11-18,21H,1,9-10,19-20H2,3H3 |
| InChIKey | SWLQEKRPTCJFEG-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|