C27H27FO2 — CID 139633611
1-fluoro-2-phenoxy-4-[4-(4-prop-2-enoxyphenyl)hex-5-enyl]benzene (PubChem CID 139633611) has the molecular formula C27H27FO2 and a molecular weight of 402.51 g/mol. Its IUPAC name is 1-fluoro-2-phenoxy-4-[4-(4-prop-2-enoxyphenyl)hex-5-enyl]benzene.
| Compound Name | 1-fluoro-2-phenoxy-4-[4-(4-prop-2-enoxyphenyl)hex-5-enyl]benzene |
|---|---|
| PubChem CID | 139633611 |
| Molecular Formula | C27H27FO2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 1-fluoro-2-phenoxy-4-[4-(4-prop-2-enoxyphenyl)hex-5-enyl]benzene |
| SMILES | C=CCOc1ccc(C(C=C)CCCc2ccc(F)c(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H27FO2/c1-3-19-29-24-16-14-23(15-17-24)22(4-2)10-8-9-21-13-18-26(28)27(20-21)30-25-11-6-5-7-12-25/h3-7,11-18,20,22H,1-2,8-10,19H2 |
| InChIKey | OWAGLZJKQNVJLD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|