C25H29FO2Si- — CID 143888632
CID 143888632 (PubChem CID 143888632) has the molecular formula C25H29FO2Si- and a molecular weight of 408.59 g/mol.
| Compound Name | CID 143888632 |
|---|---|
| PubChem CID | 143888632 |
| Molecular Formula | C25H29FO2Si- |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | — |
| SMILES | CCOc1ccc([Si-](C)(C)CCCc2ccc(F)c(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H29FO2Si/c1-4-27-21-13-15-23(16-14-21)29(2,3)18-8-9-20-12-17-24(26)25(19-20)28-22-10-6-5-7-11-22/h5-7,10-17,19H,4,8-9,18H2,1-3H3/q-1 |
| InChIKey | DJXIIALERIHDQT-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|