C29H33FO3 — CID 70412699
1,2-diethoxy-4-[6-(4-fluoro-3-phenoxyphenyl)-3-methylhex-1-en-3-yl]benzene (PubChem CID 70412699) has the molecular formula C29H33FO3 and a molecular weight of 448.58 g/mol. Its IUPAC name is 1,2-diethoxy-4-[6-(4-fluoro-3-phenoxyphenyl)-3-methylhex-1-en-3-yl]benzene.
| Compound Name | 1,2-diethoxy-4-[6-(4-fluoro-3-phenoxyphenyl)-3-methylhex-1-en-3-yl]benzene |
|---|---|
| PubChem CID | 70412699 |
| Molecular Formula | C29H33FO3 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1,2-diethoxy-4-[6-(4-fluoro-3-phenoxyphenyl)-3-methylhex-1-en-3-yl]benzene |
| SMILES | C=CC(C)(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C29H33FO3/c1-5-29(4,23-16-18-26(31-6-2)28(21-23)32-7-3)19-11-12-22-15-17-25(30)27(20-22)33-24-13-9-8-10-14-24/h5,8-10,13-18,20-21H,1,6-7,11-12,19H2,2-4H3 |
| InChIKey | OZESRIMZWFRPSY-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|