C25H22ClF2IO — CID 173402048
1-chloro-2-fluoro-4-[6-(4-fluoro-3-phenoxyphenyl)-1-iodo-3-methylhex-1-en-3-yl]benzene (PubChem CID 173402048) has the molecular formula C25H22ClF2IO and a molecular weight of 538.80 g/mol. Its IUPAC name is 1-chloro-2-fluoro-4-[6-(4-fluoro-3-phenoxyphenyl)-1-iodo-3-methylhex-1-en-3-yl]benzene.
| Compound Name | 1-chloro-2-fluoro-4-[6-(4-fluoro-3-phenoxyphenyl)-1-iodo-3-methylhex-1-en-3-yl]benzene |
|---|---|
| PubChem CID | 173402048 |
| Molecular Formula | C25H22ClF2IO |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | 1-chloro-2-fluoro-4-[6-(4-fluoro-3-phenoxyphenyl)-1-iodo-3-methylhex-1-en-3-yl]benzene |
| SMILES | CC(C=CI)(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C25H22ClF2IO/c1-25(14-15-29,19-10-11-21(26)23(28)17-19)13-5-6-18-9-12-22(27)24(16-18)30-20-7-3-2-4-8-20/h2-4,7-12,14-17H,5-6,13H2,1H3 |
| InChIKey | CHYKWNAUWZBPCD-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|