C22H23Cl2FO — CID 139608574
4-(8,8-dichloro-4,4-dimethylocta-5,7-dienyl)-1-fluoro-2-phenoxybenzene (PubChem CID 139608574) has the molecular formula C22H23Cl2FO and a molecular weight of 393.33 g/mol. Its IUPAC name is 4-(8,8-dichloro-4,4-dimethylocta-5,7-dienyl)-1-fluoro-2-phenoxybenzene.
| Compound Name | 4-(8,8-dichloro-4,4-dimethylocta-5,7-dienyl)-1-fluoro-2-phenoxybenzene |
|---|---|
| PubChem CID | 139608574 |
| Molecular Formula | C22H23Cl2FO |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-(8,8-dichloro-4,4-dimethylocta-5,7-dienyl)-1-fluoro-2-phenoxybenzene |
| SMILES | CC(C)(C=CC=C(Cl)Cl)CCCc1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H23Cl2FO/c1-22(2,15-7-11-21(23)24)14-6-8-17-12-13-19(25)20(16-17)26-18-9-4-3-5-10-18/h3-5,7,9-13,15-16H,6,8,14H2,1-2H3 |
| InChIKey | RIRWOTAIHSNAKY-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|