C29H31FO2 — CID 88646070
4-[4-(4-ethoxyphenyl)-4-propan-2-ylhex-5-ynyl]-1-fluoro-2-phenoxybenzene (PubChem CID 88646070) has the molecular formula C29H31FO2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 4-[4-(4-ethoxyphenyl)-4-propan-2-ylhex-5-ynyl]-1-fluoro-2-phenoxybenzene.
| Compound Name | 4-[4-(4-ethoxyphenyl)-4-propan-2-ylhex-5-ynyl]-1-fluoro-2-phenoxybenzene |
|---|---|
| PubChem CID | 88646070 |
| Molecular Formula | C29H31FO2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 4-[4-(4-ethoxyphenyl)-4-propan-2-ylhex-5-ynyl]-1-fluoro-2-phenoxybenzene |
| SMILES | C#CC(CCCc1ccc(F)c(Oc2ccccc2)c1)(c1ccc(OCC)cc1)C(C)C |
| InChI | InChI=1S/C29H31FO2/c1-5-29(22(3)4,24-15-17-25(18-16-24)31-6-2)20-10-11-23-14-19-27(30)28(21-23)32-26-12-8-7-9-13-26/h1,7-9,12-19,21-22H,6,10-11,20H2,2-4H3 |
| InChIKey | UOIDYABSYMQCDA-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|