C25H27FO3 — CID 15582662
4-[[2-(4-ethoxyphenyl)-2-methylpropoxy]methyl]-1-fluoro-2-phenoxybenzene (PubChem CID 15582662) has the molecular formula C25H27FO3 and a molecular weight of 394.49 g/mol. Its IUPAC name is 4-[[2-(4-ethoxyphenyl)-2-methylpropoxy]methyl]-1-fluoro-2-phenoxybenzene.
| Compound Name | 4-[[2-(4-ethoxyphenyl)-2-methylpropoxy]methyl]-1-fluoro-2-phenoxybenzene |
|---|---|
| PubChem CID | 15582662 |
| Molecular Formula | C25H27FO3 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 4-[[2-(4-ethoxyphenyl)-2-methylpropoxy]methyl]-1-fluoro-2-phenoxybenzene |
| SMILES | CCOc1ccc(C(C)(C)COCc2ccc(F)c(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H27FO3/c1-4-28-21-13-11-20(12-14-21)25(2,3)18-27-17-19-10-15-23(26)24(16-19)29-22-8-6-5-7-9-22/h5-16H,4,17-18H2,1-3H3 |
| InChIKey | KUXGUCLLZWQAGF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |