C23H22FIO2 — CID 15582674
1-fluoro-4-[[2-(4-iodophenyl)-2-methylpropoxy]methyl]-2-phenoxybenzene (PubChem CID 15582674) has the molecular formula C23H22FIO2 and a molecular weight of 476.33 g/mol. Its IUPAC name is 1-fluoro-4-[[2-(4-iodophenyl)-2-methylpropoxy]methyl]-2-phenoxybenzene.
| Compound Name | 1-fluoro-4-[[2-(4-iodophenyl)-2-methylpropoxy]methyl]-2-phenoxybenzene |
|---|---|
| PubChem CID | 15582674 |
| Molecular Formula | C23H22FIO2 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 1-fluoro-4-[[2-(4-iodophenyl)-2-methylpropoxy]methyl]-2-phenoxybenzene |
| SMILES | CC(C)(COCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(I)cc1 |
| InChI | InChI=1S/C23H22FIO2/c1-23(2,18-9-11-19(25)12-10-18)16-26-15-17-8-13-21(24)22(14-17)27-20-6-4-3-5-7-20/h3-14H,15-16H2,1-2H3 |
| InChIKey | HDJPFKSMKATVGF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|