C22H16ClF5O2 — CID 14516994
4-[[2-chloro-3,3,3-trifluoro-2-(4-fluorophenyl)propoxy]methyl]-1-fluoro-2-phenoxybenzene (PubChem CID 14516994) has the molecular formula C22H16ClF5O2 and a molecular weight of 442.81 g/mol. Its IUPAC name is 4-[[2-chloro-3,3,3-trifluoro-2-(4-fluorophenyl)propoxy]methyl]-1-fluoro-2-phenoxybenzene.
| Compound Name | 4-[[2-chloro-3,3,3-trifluoro-2-(4-fluorophenyl)propoxy]methyl]-1-fluoro-2-phenoxybenzene |
|---|---|
| PubChem CID | 14516994 |
| Molecular Formula | C22H16ClF5O2 |
| Molecular Weight | 442.81 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 4-[[2-chloro-3,3,3-trifluoro-2-(4-fluorophenyl)propoxy]methyl]-1-fluoro-2-phenoxybenzene |
| SMILES | Fc1ccc(C(Cl)(COCc2ccc(F)c(Oc3ccccc3)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H16ClF5O2/c23-21(22(26,27)28,16-7-9-17(24)10-8-16)14-29-13-15-6-11-19(25)20(12-15)30-18-4-2-1-3-5-18/h1-12H,13-14H2 |
| InChIKey | SPFUZWPTHNVRSW-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.81 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|