C23H17ClF6O3 — CID 14517006
1-[2-chloro-1,1,1-trifluoro-3-[(3-phenoxyphenyl)methoxy]propan-2-yl]-4-(trifluoromethoxy)benzene (PubChem CID 14517006) has the molecular formula C23H17ClF6O3 and a molecular weight of 490.83 g/mol. Its IUPAC name is 1-[2-chloro-1,1,1-trifluoro-3-[(3-phenoxyphenyl)methoxy]propan-2-yl]-4-(trifluoromethoxy)benzene.
| Compound Name | 1-[2-chloro-1,1,1-trifluoro-3-[(3-phenoxyphenyl)methoxy]propan-2-yl]-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 14517006 |
| Molecular Formula | C23H17ClF6O3 |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 1-[2-chloro-1,1,1-trifluoro-3-[(3-phenoxyphenyl)methoxy]propan-2-yl]-4-(trifluoromethoxy)benzene |
| SMILES | FC(F)(F)Oc1ccc(C(Cl)(COCc2cccc(Oc3ccccc3)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17ClF6O3/c24-21(22(25,26)27,17-9-11-19(12-10-17)33-23(28,29)30)15-31-14-16-5-4-8-20(13-16)32-18-6-2-1-3-7-18/h1-13H,14-15H2 |
| InChIKey | PAIVILBJZHBYST-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|