C23H18ClF3O4 — CID 14517012
5-[2-chloro-1,1,1-trifluoro-3-[(3-phenoxyphenyl)methoxy]propan-2-yl]-1,3-benzodioxole (PubChem CID 14517012) has the molecular formula C23H18ClF3O4 and a molecular weight of 450.84 g/mol. Its IUPAC name is 5-[2-chloro-1,1,1-trifluoro-3-[(3-phenoxyphenyl)methoxy]propan-2-yl]-1,3-benzodioxole.
| Compound Name | 5-[2-chloro-1,1,1-trifluoro-3-[(3-phenoxyphenyl)methoxy]propan-2-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 14517012 |
| Molecular Formula | C23H18ClF3O4 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 5-[2-chloro-1,1,1-trifluoro-3-[(3-phenoxyphenyl)methoxy]propan-2-yl]-1,3-benzodioxole |
| SMILES | FC(F)(F)C(Cl)(COCc1cccc(Oc2ccccc2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H18ClF3O4/c24-22(23(25,26)27,17-9-10-20-21(12-17)30-15-29-20)14-28-13-16-5-4-8-19(11-16)31-18-6-2-1-3-7-18/h1-12H,13-15H2 |
| InChIKey | RBMDIPMKYLXOOD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|