C17H17F3O2 — CID 70229700
1-phenoxy-3-(4,4,4-trifluorobutoxymethyl)benzene (PubChem CID 70229700) has the molecular formula C17H17F3O2 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1-phenoxy-3-(4,4,4-trifluorobutoxymethyl)benzene.
| Compound Name | 1-phenoxy-3-(4,4,4-trifluorobutoxymethyl)benzene |
|---|---|
| PubChem CID | 70229700 |
| Molecular Formula | C17H17F3O2 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-phenoxy-3-(4,4,4-trifluorobutoxymethyl)benzene |
| SMILES | FC(F)(F)CCCOCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C17H17F3O2/c18-17(19,20)10-5-11-21-13-14-6-4-9-16(12-14)22-15-7-2-1-3-8-15/h1-4,6-9,12H,5,10-11,13H2 |
| InChIKey | UDFDJZRJHPHMDV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|