C12H12F4O3 — CID 107881260
2-fluoro-5-(4,4,4-trifluorobutoxymethyl)benzoic acid (PubChem CID 107881260) has the molecular formula C12H12F4O3 and a molecular weight of 280.22 g/mol. Its IUPAC name is 2-fluoro-5-(4,4,4-trifluorobutoxymethyl)benzoic acid.
| Compound Name | 2-fluoro-5-(4,4,4-trifluorobutoxymethyl)benzoic acid |
|---|---|
| PubChem CID | 107881260 |
| Molecular Formula | C12H12F4O3 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-fluoro-5-(4,4,4-trifluorobutoxymethyl)benzoic acid |
| SMILES | O=C(O)c1cc(COCCCC(F)(F)F)ccc1F |
| InChI | InChI=1S/C12H12F4O3/c13-10-3-2-8(6-9(10)11(17)18)7-19-5-1-4-12(14,15)16/h2-3,6H,1,4-5,7H2,(H,17,18) |
| InChIKey | YCXLNVXPDJYADO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|