C14H15F3O3 — CID 82787822
(E)-3-[3-(4,4,4-trifluorobutoxymethyl)phenyl]prop-2-enoic acid (PubChem CID 82787822) has the molecular formula C14H15F3O3 and a molecular weight of 288.26 g/mol. Its IUPAC name is (E)-3-[3-(4,4,4-trifluorobutoxymethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(4,4,4-trifluorobutoxymethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82787822 |
| Molecular Formula | C14H15F3O3 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (E)-3-[3-(4,4,4-trifluorobutoxymethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(COCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3O3/c15-14(16,17)7-2-8-20-10-12-4-1-3-11(9-12)5-6-13(18)19/h1,3-6,9H,2,7-8,10H2,(H,18,19)/b6-5+ |
| InChIKey | BNADMQKIZXLXNK-AATRIKPKSA-N |
| XLogP | 3.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|