C13H13F3O3 — CID 82958307
(E)-3-[3-(3,3,3-trifluoropropoxymethyl)phenyl]prop-2-enoic acid (PubChem CID 82958307) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is (E)-3-[3-(3,3,3-trifluoropropoxymethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(3,3,3-trifluoropropoxymethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82958307 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (E)-3-[3-(3,3,3-trifluoropropoxymethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(COCCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3O3/c14-13(15,16)6-7-19-9-11-3-1-2-10(8-11)4-5-12(17)18/h1-5,8H,6-7,9H2,(H,17,18)/b5-4+ |
| InChIKey | UGYNEWILXPCPGS-SNAWJCMRSA-N |
| XLogP | 3.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|