C12H11F3O5S — CID 174429672
(E)-3-[3-[2-(trifluoromethylsulfonyloxy)ethyl]phenyl]prop-2-enoic acid (PubChem CID 174429672) has the molecular formula C12H11F3O5S and a molecular weight of 324.28 g/mol. Its IUPAC name is (E)-3-[3-[2-(trifluoromethylsulfonyloxy)ethyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-(trifluoromethylsulfonyloxy)ethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 174429672 |
| Molecular Formula | C12H11F3O5S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (E)-3-[3-[2-(trifluoromethylsulfonyloxy)ethyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(CCOS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3O5S/c13-12(14,15)21(18,19)20-7-6-10-3-1-2-9(8-10)4-5-11(16)17/h1-5,8H,6-7H2,(H,16,17)/b5-4+ |
| InChIKey | XOIKKVFZPIRIBB-SNAWJCMRSA-N |
| XLogP | 2.19 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|