5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid

C12H12F4O3 — CID 82793146

IUPAC5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid
SMILESO=C(O)c1cc(F)ccc1COCCCC(F)(F)F
InChIInChI=1S/C12H12F4O3/c13-9-3-2-8(10(6-9)11(17)18)7-19-5-1-4-12(14,15)16/h2-3,6H,1,4-5,7H2,(H,17,18)
InChIKeyUJPAKKBBDOZCMT-UHFFFAOYSA-N
MW280.22 g/mol
LogP3.38
Rot. Bonds6

About 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid

5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid (PubChem CID 82793146) has the molecular formula C12H12F4O3 and a molecular weight of 280.22 g/mol. Its IUPAC name is 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid.

Molecular Properties

Compound Name5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid
PubChem CID82793146
Molecular FormulaC12H12F4O3
Molecular Weight280.22 g/mol
Exact Mass280.07
IUPAC Name5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid
SMILESO=C(O)c1cc(F)ccc1COCCCC(F)(F)F
InChIInChI=1S/C12H12F4O3/c13-9-3-2-8(10(6-9)11(17)18)7-19-5-1-4-12(14,15)16/h2-3,6H,1,4-5,7H2,(H,17,18)
InChIKeyUJPAKKBBDOZCMT-UHFFFAOYSA-N
XLogP3.38
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.22
LogP ≤ 53.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid?
The IUPAC name of 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid (CID 82793146) is 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid.
What is the SMILES notation for 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid?
The canonical SMILES for 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid is O=C(O)c1cc(F)ccc1COCCCC(F)(F)F.
What is the InChIKey of 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid?
The InChIKey is UJPAKKBBDOZCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F4O3/c13-9-3-2-8(10(6-9)11(17)18)7-19-5-1-4-12(14,15)16/h2-3,6H,1,4-5,7H2,(H,17,18).
What are the key properties of 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid?
5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid has a molecular weight of 280.22 g/mol, XLogP of 3.38, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-(4,4,4-trifluorobutoxymethyl)benzoic acid is sourced from PubChem (CID 82793146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).