C11H11BrF4O — CID 82787646
2-bromo-4-fluoro-1-(4,4,4-trifluorobutoxymethyl)benzene (PubChem CID 82787646) has the molecular formula C11H11BrF4O and a molecular weight of 315.10 g/mol. Its IUPAC name is 2-bromo-4-fluoro-1-(4,4,4-trifluorobutoxymethyl)benzene.
| Compound Name | 2-bromo-4-fluoro-1-(4,4,4-trifluorobutoxymethyl)benzene |
|---|---|
| PubChem CID | 82787646 |
| Molecular Formula | C11H11BrF4O |
| Molecular Weight | 315.10 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 2-bromo-4-fluoro-1-(4,4,4-trifluorobutoxymethyl)benzene |
| SMILES | Fc1ccc(COCCCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrF4O/c12-10-6-9(13)3-2-8(10)7-17-5-1-4-11(14,15)16/h2-3,6H,1,4-5,7H2 |
| InChIKey | HFNVGBSHLGWXPU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.10 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|