C11H13ClF3NO — CID 82789716
4-chloro-2-(4,4,4-trifluorobutoxymethyl)aniline (PubChem CID 82789716) has the molecular formula C11H13ClF3NO and a molecular weight of 267.68 g/mol. Its IUPAC name is 4-chloro-2-(4,4,4-trifluorobutoxymethyl)aniline.
| Compound Name | 4-chloro-2-(4,4,4-trifluorobutoxymethyl)aniline |
|---|---|
| PubChem CID | 82789716 |
| Molecular Formula | C11H13ClF3NO |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-chloro-2-(4,4,4-trifluorobutoxymethyl)aniline |
| SMILES | Nc1ccc(Cl)cc1COCCCC(F)(F)F |
| InChI | InChI=1S/C11H13ClF3NO/c12-9-2-3-10(16)8(6-9)7-17-5-1-4-11(13,14)15/h2-3,6H,1,4-5,7,16H2 |
| InChIKey | XHAYOMDZVYZSHN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|