C10H11ClF3NO — CID 82955578
5-chloro-2-(3,3,3-trifluoropropoxymethyl)aniline (PubChem CID 82955578) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is 5-chloro-2-(3,3,3-trifluoropropoxymethyl)aniline.
| Compound Name | 5-chloro-2-(3,3,3-trifluoropropoxymethyl)aniline |
|---|---|
| PubChem CID | 82955578 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 5-chloro-2-(3,3,3-trifluoropropoxymethyl)aniline |
| SMILES | Nc1cc(Cl)ccc1COCCC(F)(F)F |
| InChI | InChI=1S/C10H11ClF3NO/c11-8-2-1-7(9(15)5-8)6-16-4-3-10(12,13)14/h1-2,5H,3-4,6,15H2 |
| InChIKey | POTGJGMMOCYFKU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|