C13H13F4NO — CID 82954541
3-[3-fluoro-4-(3,3,3-trifluoropropoxymethyl)phenyl]prop-2-yn-1-amine (PubChem CID 82954541) has the molecular formula C13H13F4NO and a molecular weight of 275.25 g/mol. Its IUPAC name is 3-[3-fluoro-4-(3,3,3-trifluoropropoxymethyl)phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[3-fluoro-4-(3,3,3-trifluoropropoxymethyl)phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 82954541 |
| Molecular Formula | C13H13F4NO |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[3-fluoro-4-(3,3,3-trifluoropropoxymethyl)phenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccc(COCCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H13F4NO/c14-12-8-10(2-1-6-18)3-4-11(12)9-19-7-5-13(15,16)17/h3-4,8H,5-7,9,18H2 |
| InChIKey | ZKDGCOPTTOCTSZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|