C16H21FO3 — CID 106666501
3-[3-fluoro-4-[(3-methoxy-3-methylbutoxy)methyl]phenyl]prop-2-yn-1-ol (PubChem CID 106666501) has the molecular formula C16H21FO3 and a molecular weight of 280.34 g/mol. Its IUPAC name is 3-[3-fluoro-4-[(3-methoxy-3-methylbutoxy)methyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-fluoro-4-[(3-methoxy-3-methylbutoxy)methyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 106666501 |
| Molecular Formula | C16H21FO3 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-[3-fluoro-4-[(3-methoxy-3-methylbutoxy)methyl]phenyl]prop-2-yn-1-ol |
| SMILES | COC(C)(C)CCOCc1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C16H21FO3/c1-16(2,19-3)8-10-20-12-14-7-6-13(5-4-9-18)11-15(14)17/h6-7,11,18H,8-10,12H2,1-3H3 |
| InChIKey | WVCMHRIUAXNNTB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|