C10H10FNO — CID 169485026
3-[4-(aminomethyl)-3-fluorophenyl]prop-2-yn-1-ol (PubChem CID 169485026) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-3-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-(aminomethyl)-3-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 169485026 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 3-[4-(aminomethyl)-3-fluorophenyl]prop-2-yn-1-ol |
| SMILES | NCc1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C10H10FNO/c11-10-6-8(2-1-5-13)3-4-9(10)7-12/h3-4,6,13H,5,7,12H2 |
| InChIKey | BHGOGFQQNBMWLX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|