C16H21FO2 — CID 103284681
3-[3-fluoro-4-(2-methylpentoxymethyl)phenyl]prop-2-yn-1-ol (PubChem CID 103284681) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is 3-[3-fluoro-4-(2-methylpentoxymethyl)phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-fluoro-4-(2-methylpentoxymethyl)phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 103284681 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-[3-fluoro-4-(2-methylpentoxymethyl)phenyl]prop-2-yn-1-ol |
| SMILES | CCCC(C)COCc1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C16H21FO2/c1-3-5-13(2)11-19-12-15-8-7-14(6-4-9-18)10-16(15)17/h7-8,10,13,18H,3,5,9,11-12H2,1-2H3 |
| InChIKey | CGQVWBBJHKJQSQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|