C13H10FNO2S — CID 63312367
3-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,3-thiazol-2-one (PubChem CID 63312367) has the molecular formula C13H10FNO2S and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,3-thiazol-2-one.
| Compound Name | 3-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 63312367 |
| Molecular Formula | C13H10FNO2S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 3-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,3-thiazol-2-one |
| SMILES | O=c1sccn1Cc1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C13H10FNO2S/c14-12-8-10(2-1-6-16)3-4-11(12)9-15-5-7-18-13(15)17/h3-5,7-8,16H,6,9H2 |
| InChIKey | YBTRAXDXEOYOQE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|