C14H12FNO2S — CID 79709807
3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3-thiazol-2-one (PubChem CID 79709807) has the molecular formula C14H12FNO2S and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3-thiazol-2-one.
| Compound Name | 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 79709807 |
| Molecular Formula | C14H12FNO2S |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3-thiazol-2-one |
| SMILES | O=c1sccn1Cc1cc(F)cc(C#CCCO)c1 |
| InChI | InChI=1S/C14H12FNO2S/c15-13-8-11(3-1-2-5-17)7-12(9-13)10-16-4-6-19-14(16)18/h4,6-9,17H,2,5,10H2 |
| InChIKey | VKQOQWHLGYMCNV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|