C14H13NO3S — CID 65323692
3-[[2-(3-hydroxyprop-1-ynyl)-5-methoxyphenyl]methyl]-1,3-thiazol-2-one (PubChem CID 65323692) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 3-[[2-(3-hydroxyprop-1-ynyl)-5-methoxyphenyl]methyl]-1,3-thiazol-2-one.
| Compound Name | 3-[[2-(3-hydroxyprop-1-ynyl)-5-methoxyphenyl]methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 65323692 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3-[[2-(3-hydroxyprop-1-ynyl)-5-methoxyphenyl]methyl]-1,3-thiazol-2-one |
| SMILES | COc1ccc(C#CCO)c(Cn2ccsc2=O)c1 |
| InChI | InChI=1S/C14H13NO3S/c1-18-13-5-4-11(3-2-7-16)12(9-13)10-15-6-8-19-14(15)17/h4-6,8-9,16H,7,10H2,1H3 |
| InChIKey | AWZBTGSHRTZBRR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|