C14H14N2O2S3 — CID 115383351
3-[4-methoxy-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol (PubChem CID 115383351) has the molecular formula C14H14N2O2S3 and a molecular weight of 338.48 g/mol. Its IUPAC name is 3-[4-methoxy-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-methoxy-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 115383351 |
| Molecular Formula | C14H14N2O2S3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 3-[4-methoxy-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol |
| SMILES | COc1ccc(C#CCO)c(CSc2nnc(SC)s2)c1 |
| InChI | InChI=1S/C14H14N2O2S3/c1-18-12-6-5-10(4-3-7-17)11(8-12)9-20-14-16-15-13(19-2)21-14/h5-6,8,17H,7,9H2,1-2H3 |
| InChIKey | OSYKUKJIELXINW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|