C13H11FN2OS3 — CID 115383344
3-[5-fluoro-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol (PubChem CID 115383344) has the molecular formula C13H11FN2OS3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-[5-fluoro-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[5-fluoro-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 115383344 |
| Molecular Formula | C13H11FN2OS3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 3-[5-fluoro-2-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-ol |
| SMILES | CSc1nnc(SCc2ccc(F)cc2C#CCO)s1 |
| InChI | InChI=1S/C13H11FN2OS3/c1-18-12-15-16-13(20-12)19-8-10-4-5-11(14)7-9(10)3-2-6-17/h4-5,7,17H,6,8H2,1H3 |
| InChIKey | DSYKKDDIPOCWCS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|