C13H11FN2O2S3 — CID 115383364
(E)-3-[3-fluoro-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid (PubChem CID 115383364) has the molecular formula C13H11FN2O2S3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115383364 |
| Molecular Formula | C13H11FN2O2S3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | (E)-3-[3-fluoro-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]prop-2-enoic acid |
| SMILES | CSc1nnc(SCc2ccc(/C=C/C(=O)O)cc2F)s1 |
| InChI | InChI=1S/C13H11FN2O2S3/c1-19-12-15-16-13(21-12)20-7-9-4-2-8(6-10(9)14)3-5-11(17)18/h2-6H,7H2,1H3,(H,17,18)/b5-3+ |
| InChIKey | IRBMLVZNQYOTFN-HWKANZROSA-N |
| XLogP | 3.79 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|