C15H20FNO2S — CID 115987116
(E)-3-[3-fluoro-4-[[methyl(1-methylsulfanylpropan-2-yl)amino]methyl]phenyl]prop-2-enoic acid (PubChem CID 115987116) has the molecular formula C15H20FNO2S and a molecular weight of 297.40 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-[[methyl(1-methylsulfanylpropan-2-yl)amino]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-4-[[methyl(1-methylsulfanylpropan-2-yl)amino]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115987116 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (E)-3-[3-fluoro-4-[[methyl(1-methylsulfanylpropan-2-yl)amino]methyl]phenyl]prop-2-enoic acid |
| SMILES | CSCC(C)N(C)Cc1ccc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C15H20FNO2S/c1-11(10-20-3)17(2)9-13-6-4-12(8-14(13)16)5-7-15(18)19/h4-8,11H,9-10H2,1-3H3,(H,18,19)/b7-5+ |
| InChIKey | UHBOFYUDWPXOMQ-FNORWQNLSA-N |
| XLogP | 3.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|