C13H16FNO2S — CID 112662454
(E)-3-[3-fluoro-4-[methyl(2-methylsulfanylethyl)amino]phenyl]prop-2-enoic acid (PubChem CID 112662454) has the molecular formula C13H16FNO2S and a molecular weight of 269.34 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-[methyl(2-methylsulfanylethyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-4-[methyl(2-methylsulfanylethyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 112662454 |
| Molecular Formula | C13H16FNO2S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (E)-3-[3-fluoro-4-[methyl(2-methylsulfanylethyl)amino]phenyl]prop-2-enoic acid |
| SMILES | CSCCN(C)c1ccc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C13H16FNO2S/c1-15(7-8-18-2)12-5-3-10(9-11(12)14)4-6-13(16)17/h3-6,9H,7-8H2,1-2H3,(H,16,17)/b6-4+ |
| InChIKey | GSUDRGDDPYKVTI-GQCTYLIASA-N |
| XLogP | 2.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|